C17H19N5S — CID 100790557
1-cyclopropyl-3-[4-(1,3-dihydroisoindol-2-yl)-6-methylpyrimidin-2-yl]thiourea (PubChem CID 100790557) has the molecular formula C17H19N5S and a molecular weight of 325.44 g/mol. Its IUPAC name is 1-cyclopropyl-3-[4-(1,3-dihydroisoindol-2-yl)-6-methylpyrimidin-2-yl]thiourea.
| Compound Name | 1-cyclopropyl-3-[4-(1,3-dihydroisoindol-2-yl)-6-methylpyrimidin-2-yl]thiourea |
|---|---|
| PubChem CID | 100790557 |
| Molecular Formula | C17H19N5S |
| Molecular Weight | 325.44 g/mol |
| Exact Mass | 325.14 |
| IUPAC Name | 1-cyclopropyl-3-[4-(1,3-dihydroisoindol-2-yl)-6-methylpyrimidin-2-yl]thiourea |
| SMILES | Cc1cc(N2Cc3ccccc3C2)nc(NC(=S)NC2CC2)n1 |
| InChI | InChI=1S/C17H19N5S/c1-11-8-15(22-9-12-4-2-3-5-13(12)10-22)20-16(18-11)21-17(23)19-14-6-7-14/h2-5,8,14H,6-7,9-10H2,1H3,(H2,18,19,20,21,23) |
| InChIKey | RWVPCMYZZGISIM-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 53.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.44 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|