C29H28N6S — CID 100785093
1-[4,6-bis(1,3-dihydroisoindol-2-yl)pyrimidin-2-yl]-3-[(1S)-1-phenylethyl]thiourea (PubChem CID 100785093) has the molecular formula C29H28N6S and a molecular weight of 492.65 g/mol. Its IUPAC name is 1-[4,6-bis(1,3-dihydroisoindol-2-yl)pyrimidin-2-yl]-3-[(1S)-1-phenylethyl]thiourea.
| Compound Name | 1-[4,6-bis(1,3-dihydroisoindol-2-yl)pyrimidin-2-yl]-3-[(1S)-1-phenylethyl]thiourea |
|---|---|
| PubChem CID | 100785093 |
| Molecular Formula | C29H28N6S |
| Molecular Weight | 492.65 g/mol |
| Exact Mass | 492.21 |
| IUPAC Name | 1-[4,6-bis(1,3-dihydroisoindol-2-yl)pyrimidin-2-yl]-3-[(1S)-1-phenylethyl]thiourea |
| SMILES | C[C@H](NC(=S)Nc1nc(N2Cc3ccccc3C2)cc(N2Cc3ccccc3C2)n1)c1ccccc1 |
| InChI | InChI=1S/C29H28N6S/c1-20(21-9-3-2-4-10-21)30-29(36)33-28-31-26(34-16-22-11-5-6-12-23(22)17-34)15-27(32-28)35-18-24-13-7-8-14-25(24)19-35/h2-15,20H,16-19H2,1H3,(H2,30,31,32,33,36)/t20-/m0/s1 |
| InChIKey | SQMCELGIRXJQBY-FQEVSTJZSA-N |
| XLogP | 5.56 |
| TPSA | 56.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.65 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|