C29H37N7S — CID 100784916
1-[4-(4-methylpiperidin-1-yl)-6-(4-phenylpiperazin-1-yl)pyrimidin-2-yl]-3-[(1R)-1-phenylethyl]thiourea (PubChem CID 100784916) has the molecular formula C29H37N7S and a molecular weight of 515.73 g/mol. Its IUPAC name is 1-[4-(4-methylpiperidin-1-yl)-6-(4-phenylpiperazin-1-yl)pyrimidin-2-yl]-3-[(1R)-1-phenylethyl]thiourea.
| Compound Name | 1-[4-(4-methylpiperidin-1-yl)-6-(4-phenylpiperazin-1-yl)pyrimidin-2-yl]-3-[(1R)-1-phenylethyl]thiourea |
|---|---|
| PubChem CID | 100784916 |
| Molecular Formula | C29H37N7S |
| Molecular Weight | 515.73 g/mol |
| Exact Mass | 515.28 |
| IUPAC Name | 1-[4-(4-methylpiperidin-1-yl)-6-(4-phenylpiperazin-1-yl)pyrimidin-2-yl]-3-[(1R)-1-phenylethyl]thiourea |
| SMILES | CC1CCN(c2cc(N3CCN(c4ccccc4)CC3)nc(NC(=S)N[C@H](C)c3ccccc3)n2)CC1 |
| InChI | InChI=1S/C29H37N7S/c1-22-13-15-35(16-14-22)26-21-27(36-19-17-34(18-20-36)25-11-7-4-8-12-25)32-28(31-26)33-29(37)30-23(2)24-9-5-3-6-10-24/h3-12,21-23H,13-20H2,1-2H3,(H2,30,31,32,33,37)/t23-/m1/s1 |
| InChIKey | FUDSBWTZXIVUKR-HSZRJFAPSA-N |
| XLogP | 5.09 |
| TPSA | 59.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.73 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|