C24H34N6S — CID 100784665
1-[4-[(3R,5S)-3,5-dimethylpiperidin-1-yl]-6-pyrrolidin-1-ylpyrimidin-2-yl]-3-[(1S)-1-phenylethyl]thiourea (PubChem CID 100784665) has the molecular formula C24H34N6S and a molecular weight of 438.65 g/mol. Its IUPAC name is 1-[4-[(3R,5S)-3,5-dimethylpiperidin-1-yl]-6-pyrrolidin-1-ylpyrimidin-2-yl]-3-[(1S)-1-phenylethyl]thiourea.
| Compound Name | 1-[4-[(3R,5S)-3,5-dimethylpiperidin-1-yl]-6-pyrrolidin-1-ylpyrimidin-2-yl]-3-[(1S)-1-phenylethyl]thiourea |
|---|---|
| PubChem CID | 100784665 |
| Molecular Formula | C24H34N6S |
| Molecular Weight | 438.65 g/mol |
| Exact Mass | 438.26 |
| IUPAC Name | 1-[4-[(3R,5S)-3,5-dimethylpiperidin-1-yl]-6-pyrrolidin-1-ylpyrimidin-2-yl]-3-[(1S)-1-phenylethyl]thiourea |
| SMILES | C[C@@H]1C[C@H](C)CN(c2cc(N3CCCC3)nc(NC(=S)N[C@@H](C)c3ccccc3)n2)C1 |
| InChI | InChI=1S/C24H34N6S/c1-17-13-18(2)16-30(15-17)22-14-21(29-11-7-8-12-29)26-23(27-22)28-24(31)25-19(3)20-9-5-4-6-10-20/h4-6,9-10,14,17-19H,7-8,11-13,15-16H2,1-3H3,(H2,25,26,27,28,31)/t17-,18+,19-/m0/s1 |
| InChIKey | BGCMNKZMVBUEEZ-OTWHNJEPSA-N |
| XLogP | 4.61 |
| TPSA | 56.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.65 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|