C27H33N7S — CID 100784674
1-[(1S)-1-phenylethyl]-3-[4-(4-phenylpiperazin-1-yl)-6-pyrrolidin-1-ylpyrimidin-2-yl]thiourea (PubChem CID 100784674) has the molecular formula C27H33N7S and a molecular weight of 487.68 g/mol. Its IUPAC name is 1-[(1S)-1-phenylethyl]-3-[4-(4-phenylpiperazin-1-yl)-6-pyrrolidin-1-ylpyrimidin-2-yl]thiourea.
| Compound Name | 1-[(1S)-1-phenylethyl]-3-[4-(4-phenylpiperazin-1-yl)-6-pyrrolidin-1-ylpyrimidin-2-yl]thiourea |
|---|---|
| PubChem CID | 100784674 |
| Molecular Formula | C27H33N7S |
| Molecular Weight | 487.68 g/mol |
| Exact Mass | 487.25 |
| IUPAC Name | 1-[(1S)-1-phenylethyl]-3-[4-(4-phenylpiperazin-1-yl)-6-pyrrolidin-1-ylpyrimidin-2-yl]thiourea |
| SMILES | C[C@H](NC(=S)Nc1nc(N2CCCC2)cc(N2CCN(c3ccccc3)CC2)n1)c1ccccc1 |
| InChI | InChI=1S/C27H33N7S/c1-21(22-10-4-2-5-11-22)28-27(35)31-26-29-24(33-14-8-9-15-33)20-25(30-26)34-18-16-32(17-19-34)23-12-6-3-7-13-23/h2-7,10-13,20-21H,8-9,14-19H2,1H3,(H2,28,29,30,31,35)/t21-/m0/s1 |
| InChIKey | FQMNSLVSQZUUHM-NRFANRHFSA-N |
| XLogP | 4.45 |
| TPSA | 59.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.68 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|