C24H28N6S — CID 100785160
1-[4-methyl-6-(4-phenylpiperazin-1-yl)pyrimidin-2-yl]-3-[(1S)-1-phenylethyl]thiourea (PubChem CID 100785160) has the molecular formula C24H28N6S and a molecular weight of 432.60 g/mol. Its IUPAC name is 1-[4-methyl-6-(4-phenylpiperazin-1-yl)pyrimidin-2-yl]-3-[(1S)-1-phenylethyl]thiourea.
| Compound Name | 1-[4-methyl-6-(4-phenylpiperazin-1-yl)pyrimidin-2-yl]-3-[(1S)-1-phenylethyl]thiourea |
|---|---|
| PubChem CID | 100785160 |
| Molecular Formula | C24H28N6S |
| Molecular Weight | 432.60 g/mol |
| Exact Mass | 432.21 |
| IUPAC Name | 1-[4-methyl-6-(4-phenylpiperazin-1-yl)pyrimidin-2-yl]-3-[(1S)-1-phenylethyl]thiourea |
| SMILES | Cc1cc(N2CCN(c3ccccc3)CC2)nc(NC(=S)N[C@@H](C)c2ccccc2)n1 |
| InChI | InChI=1S/C24H28N6S/c1-18-17-22(30-15-13-29(14-16-30)21-11-7-4-8-12-21)27-23(25-18)28-24(31)26-19(2)20-9-5-3-6-10-20/h3-12,17,19H,13-16H2,1-2H3,(H2,25,26,27,28,31)/t19-/m0/s1 |
| InChIKey | ZLDGAKJZDFDBGH-IBGZPJMESA-N |
| XLogP | 4.16 |
| TPSA | 56.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.60 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|