C25H28N6OS — CID 133197395
1-[4-(1,3-dihydroisoindol-2-yl)-6-morpholin-4-ylpyrimidin-2-yl]-3-(1-phenylethyl)thiourea (PubChem CID 133197395) has the molecular formula C25H28N6OS and a molecular weight of 460.61 g/mol. Its IUPAC name is 1-[4-(1,3-dihydroisoindol-2-yl)-6-morpholin-4-ylpyrimidin-2-yl]-3-(1-phenylethyl)thiourea.
| Compound Name | 1-[4-(1,3-dihydroisoindol-2-yl)-6-morpholin-4-ylpyrimidin-2-yl]-3-(1-phenylethyl)thiourea |
|---|---|
| PubChem CID | 133197395 |
| Molecular Formula | C25H28N6OS |
| Molecular Weight | 460.61 g/mol |
| Exact Mass | 460.20 |
| IUPAC Name | 1-[4-(1,3-dihydroisoindol-2-yl)-6-morpholin-4-ylpyrimidin-2-yl]-3-(1-phenylethyl)thiourea |
| SMILES | CC(NC(=S)Nc1nc(N2CCOCC2)cc(N2Cc3ccccc3C2)n1)c1ccccc1 |
| InChI | InChI=1S/C25H28N6OS/c1-18(19-7-3-2-4-8-19)26-25(33)29-24-27-22(30-11-13-32-14-12-30)15-23(28-24)31-16-20-9-5-6-10-21(20)17-31/h2-10,15,18H,11-14,16-17H2,1H3,(H2,26,27,28,29,33) |
| InChIKey | VQICMDWAYYPKNA-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 65.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.61 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|