C22H20F3N5S — CID 100785289
1-[4-(1,3-dihydroisoindol-2-yl)-6-(trifluoromethyl)pyrimidin-2-yl]-3-[(1R)-1-phenylethyl]thiourea (PubChem CID 100785289) has the molecular formula C22H20F3N5S and a molecular weight of 443.50 g/mol. Its IUPAC name is 1-[4-(1,3-dihydroisoindol-2-yl)-6-(trifluoromethyl)pyrimidin-2-yl]-3-[(1R)-1-phenylethyl]thiourea.
| Compound Name | 1-[4-(1,3-dihydroisoindol-2-yl)-6-(trifluoromethyl)pyrimidin-2-yl]-3-[(1R)-1-phenylethyl]thiourea |
|---|---|
| PubChem CID | 100785289 |
| Molecular Formula | C22H20F3N5S |
| Molecular Weight | 443.50 g/mol |
| Exact Mass | 443.14 |
| IUPAC Name | 1-[4-(1,3-dihydroisoindol-2-yl)-6-(trifluoromethyl)pyrimidin-2-yl]-3-[(1R)-1-phenylethyl]thiourea |
| SMILES | C[C@@H](NC(=S)Nc1nc(N2Cc3ccccc3C2)cc(C(F)(F)F)n1)c1ccccc1 |
| InChI | InChI=1S/C22H20F3N5S/c1-14(15-7-3-2-4-8-15)26-21(31)29-20-27-18(22(23,24)25)11-19(28-20)30-12-16-9-5-6-10-17(16)13-30/h2-11,14H,12-13H2,1H3,(H2,26,27,28,29,31)/t14-/m1/s1 |
| InChIKey | IXRPEFBNPUWAMN-CQSZACIVSA-N |
| XLogP | 5.06 |
| TPSA | 53.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.50 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|