C22H20F3N5OS — CID 100781346
1-[4-(1,3-dihydroisoindol-2-yl)-6-(trifluoromethyl)pyrimidin-2-yl]-3-[(4-methoxyphenyl)methyl]thiourea (PubChem CID 100781346) has the molecular formula C22H20F3N5OS and a molecular weight of 459.50 g/mol. Its IUPAC name is 1-[4-(1,3-dihydroisoindol-2-yl)-6-(trifluoromethyl)pyrimidin-2-yl]-3-[(4-methoxyphenyl)methyl]thiourea.
| Compound Name | 1-[4-(1,3-dihydroisoindol-2-yl)-6-(trifluoromethyl)pyrimidin-2-yl]-3-[(4-methoxyphenyl)methyl]thiourea |
|---|---|
| PubChem CID | 100781346 |
| Molecular Formula | C22H20F3N5OS |
| Molecular Weight | 459.50 g/mol |
| Exact Mass | 459.13 |
| IUPAC Name | 1-[4-(1,3-dihydroisoindol-2-yl)-6-(trifluoromethyl)pyrimidin-2-yl]-3-[(4-methoxyphenyl)methyl]thiourea |
| SMILES | COc1ccc(CNC(=S)Nc2nc(N3Cc4ccccc4C3)cc(C(F)(F)F)n2)cc1 |
| InChI | InChI=1S/C22H20F3N5OS/c1-31-17-8-6-14(7-9-17)11-26-21(32)29-20-27-18(22(23,24)25)10-19(28-20)30-12-15-4-2-3-5-16(15)13-30/h2-10H,11-13H2,1H3,(H2,26,27,28,29,32) |
| InChIKey | ZUUKDUMBMDPDKM-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 62.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.50 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|