C21H25F3N6OS — CID 100777849
1-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-6-(trifluoromethyl)pyrimidin-2-yl]-3-(2-morpholin-4-ylethyl)thiourea (PubChem CID 100777849) has the molecular formula C21H25F3N6OS and a molecular weight of 466.53 g/mol. Its IUPAC name is 1-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-6-(trifluoromethyl)pyrimidin-2-yl]-3-(2-morpholin-4-ylethyl)thiourea.
| Compound Name | 1-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-6-(trifluoromethyl)pyrimidin-2-yl]-3-(2-morpholin-4-ylethyl)thiourea |
|---|---|
| PubChem CID | 100777849 |
| Molecular Formula | C21H25F3N6OS |
| Molecular Weight | 466.53 g/mol |
| Exact Mass | 466.18 |
| IUPAC Name | 1-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-6-(trifluoromethyl)pyrimidin-2-yl]-3-(2-morpholin-4-ylethyl)thiourea |
| SMILES | FC(F)(F)c1cc(N2CCc3ccccc3C2)nc(NC(=S)NCCN2CCOCC2)n1 |
| InChI | InChI=1S/C21H25F3N6OS/c22-21(23,24)17-13-18(30-7-5-15-3-1-2-4-16(15)14-30)27-19(26-17)28-20(32)25-6-8-29-9-11-31-12-10-29/h1-4,13H,5-12,14H2,(H2,25,26,27,28,32) |
| InChIKey | YBFBLLBOUSKDFA-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 65.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.53 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|