C22H36N6OS — CID 100790971
1-cyclohexyl-3-[4-[(3S,5S)-3,5-dimethylpiperidin-1-yl]-6-morpholin-4-ylpyrimidin-2-yl]thiourea (PubChem CID 100790971) has the molecular formula C22H36N6OS and a molecular weight of 432.64 g/mol. Its IUPAC name is 1-cyclohexyl-3-[4-[(3S,5S)-3,5-dimethylpiperidin-1-yl]-6-morpholin-4-ylpyrimidin-2-yl]thiourea.
| Compound Name | 1-cyclohexyl-3-[4-[(3S,5S)-3,5-dimethylpiperidin-1-yl]-6-morpholin-4-ylpyrimidin-2-yl]thiourea |
|---|---|
| PubChem CID | 100790971 |
| Molecular Formula | C22H36N6OS |
| Molecular Weight | 432.64 g/mol |
| Exact Mass | 432.27 |
| IUPAC Name | 1-cyclohexyl-3-[4-[(3S,5S)-3,5-dimethylpiperidin-1-yl]-6-morpholin-4-ylpyrimidin-2-yl]thiourea |
| SMILES | C[C@H]1C[C@H](C)CN(c2cc(N3CCOCC3)nc(NC(=S)NC3CCCCC3)n2)C1 |
| InChI | InChI=1S/C22H36N6OS/c1-16-12-17(2)15-28(14-16)20-13-19(27-8-10-29-11-9-27)24-21(25-20)26-22(30)23-18-6-4-3-5-7-18/h13,16-18H,3-12,14-15H2,1-2H3,(H2,23,24,25,26,30)/t16-,17-/m0/s1 |
| InChIKey | YNBFAMYXSRCMOZ-IRXDYDNUSA-N |
| XLogP | 3.41 |
| TPSA | 65.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.64 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|