C27H39N7S — CID 100790755
1-cyclopentyl-3-[4-[(3R,5S)-3,5-dimethylpiperidin-1-yl]-6-(4-phenylpiperazin-1-yl)pyrimidin-2-yl]thiourea (PubChem CID 100790755) has the molecular formula C27H39N7S and a molecular weight of 493.73 g/mol. Its IUPAC name is 1-cyclopentyl-3-[4-[(3R,5S)-3,5-dimethylpiperidin-1-yl]-6-(4-phenylpiperazin-1-yl)pyrimidin-2-yl]thiourea.
| Compound Name | 1-cyclopentyl-3-[4-[(3R,5S)-3,5-dimethylpiperidin-1-yl]-6-(4-phenylpiperazin-1-yl)pyrimidin-2-yl]thiourea |
|---|---|
| PubChem CID | 100790755 |
| Molecular Formula | C27H39N7S |
| Molecular Weight | 493.73 g/mol |
| Exact Mass | 493.30 |
| IUPAC Name | 1-cyclopentyl-3-[4-[(3R,5S)-3,5-dimethylpiperidin-1-yl]-6-(4-phenylpiperazin-1-yl)pyrimidin-2-yl]thiourea |
| SMILES | C[C@@H]1C[C@H](C)CN(c2cc(N3CCN(c4ccccc4)CC3)nc(NC(=S)NC3CCCC3)n2)C1 |
| InChI | InChI=1S/C27H39N7S/c1-20-16-21(2)19-34(18-20)25-17-24(29-26(30-25)31-27(35)28-22-8-6-7-9-22)33-14-12-32(13-15-33)23-10-4-3-5-11-23/h3-5,10-11,17,20-22H,6-9,12-16,18-19H2,1-2H3,(H2,28,29,30,31,35)/t20-,21+ |
| InChIKey | ZFMGJURWUNZCLW-OYRHEFFESA-N |
| XLogP | 4.51 |
| TPSA | 59.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.73 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|