C20H32N6S — CID 100790656
1-cyclopentyl-3-[4-[(3R)-3-methylpiperidin-1-yl]-6-pyrrolidin-1-ylpyrimidin-2-yl]thiourea (PubChem CID 100790656) has the molecular formula C20H32N6S and a molecular weight of 388.59 g/mol. Its IUPAC name is 1-cyclopentyl-3-[4-[(3R)-3-methylpiperidin-1-yl]-6-pyrrolidin-1-ylpyrimidin-2-yl]thiourea.
| Compound Name | 1-cyclopentyl-3-[4-[(3R)-3-methylpiperidin-1-yl]-6-pyrrolidin-1-ylpyrimidin-2-yl]thiourea |
|---|---|
| PubChem CID | 100790656 |
| Molecular Formula | C20H32N6S |
| Molecular Weight | 388.59 g/mol |
| Exact Mass | 388.24 |
| IUPAC Name | 1-cyclopentyl-3-[4-[(3R)-3-methylpiperidin-1-yl]-6-pyrrolidin-1-ylpyrimidin-2-yl]thiourea |
| SMILES | C[C@@H]1CCCN(c2cc(N3CCCC3)nc(NC(=S)NC3CCCC3)n2)C1 |
| InChI | InChI=1S/C20H32N6S/c1-15-7-6-12-26(14-15)18-13-17(25-10-4-5-11-25)22-19(23-18)24-20(27)21-16-8-2-3-9-16/h13,15-16H,2-12,14H2,1H3,(H2,21,22,23,24,27)/t15-/m1/s1 |
| InChIKey | VAPRXZSHYMNBBE-OAHLLOKOSA-N |
| XLogP | 3.54 |
| TPSA | 56.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.59 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|