C15H25N5O2S — CID 100776717
1-(2-methoxyethyl)-3-[4-methoxy-6-[(2S)-2-methylpiperidin-1-yl]pyrimidin-2-yl]thiourea (PubChem CID 100776717) has the molecular formula C15H25N5O2S and a molecular weight of 339.47 g/mol. Its IUPAC name is 1-(2-methoxyethyl)-3-[4-methoxy-6-[(2S)-2-methylpiperidin-1-yl]pyrimidin-2-yl]thiourea.
| Compound Name | 1-(2-methoxyethyl)-3-[4-methoxy-6-[(2S)-2-methylpiperidin-1-yl]pyrimidin-2-yl]thiourea |
|---|---|
| PubChem CID | 100776717 |
| Molecular Formula | C15H25N5O2S |
| Molecular Weight | 339.47 g/mol |
| Exact Mass | 339.17 |
| IUPAC Name | 1-(2-methoxyethyl)-3-[4-methoxy-6-[(2S)-2-methylpiperidin-1-yl]pyrimidin-2-yl]thiourea |
| SMILES | COCCNC(=S)Nc1nc(OC)cc(N2CCCC[C@@H]2C)n1 |
| InChI | InChI=1S/C15H25N5O2S/c1-11-6-4-5-8-20(11)12-10-13(22-3)18-14(17-12)19-15(23)16-7-9-21-2/h10-11H,4-9H2,1-3H3,(H2,16,17,18,19,23)/t11-/m0/s1 |
| InChIKey | FGBAVFODMYFQOP-NSHDSACASA-N |
| XLogP | 1.80 |
| TPSA | 71.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.47 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|