C20H27N5O2S — CID 125049264
1-(2-methoxyethyl)-3-[4-[(2R)-2-methylpiperidin-1-yl]-6-phenoxypyrimidin-2-yl]thiourea (PubChem CID 125049264) has the molecular formula C20H27N5O2S and a molecular weight of 401.54 g/mol. Its IUPAC name is 1-(2-methoxyethyl)-3-[4-[(2R)-2-methylpiperidin-1-yl]-6-phenoxypyrimidin-2-yl]thiourea.
| Compound Name | 1-(2-methoxyethyl)-3-[4-[(2R)-2-methylpiperidin-1-yl]-6-phenoxypyrimidin-2-yl]thiourea |
|---|---|
| PubChem CID | 125049264 |
| Molecular Formula | C20H27N5O2S |
| Molecular Weight | 401.54 g/mol |
| Exact Mass | 401.19 |
| IUPAC Name | 1-(2-methoxyethyl)-3-[4-[(2R)-2-methylpiperidin-1-yl]-6-phenoxypyrimidin-2-yl]thiourea |
| SMILES | COCCNC(=S)Nc1nc(Oc2ccccc2)cc(N2CCCC[C@H]2C)n1 |
| InChI | InChI=1S/C20H27N5O2S/c1-15-8-6-7-12-25(15)17-14-18(27-16-9-4-3-5-10-16)23-19(22-17)24-20(28)21-11-13-26-2/h3-5,9-10,14-15H,6-8,11-13H2,1-2H3,(H2,21,22,23,24,28)/t15-/m1/s1 |
| InChIKey | ZOAMBXNSETVMIP-OAHLLOKOSA-N |
| XLogP | 3.58 |
| TPSA | 71.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.54 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|