C20H25N5OS — CID 100790493
1-cyclopropyl-3-[4-[(2R)-2-methylpiperidin-1-yl]-6-phenoxypyrimidin-2-yl]thiourea (PubChem CID 100790493) has the molecular formula C20H25N5OS and a molecular weight of 383.52 g/mol. Its IUPAC name is 1-cyclopropyl-3-[4-[(2R)-2-methylpiperidin-1-yl]-6-phenoxypyrimidin-2-yl]thiourea.
| Compound Name | 1-cyclopropyl-3-[4-[(2R)-2-methylpiperidin-1-yl]-6-phenoxypyrimidin-2-yl]thiourea |
|---|---|
| PubChem CID | 100790493 |
| Molecular Formula | C20H25N5OS |
| Molecular Weight | 383.52 g/mol |
| Exact Mass | 383.18 |
| IUPAC Name | 1-cyclopropyl-3-[4-[(2R)-2-methylpiperidin-1-yl]-6-phenoxypyrimidin-2-yl]thiourea |
| SMILES | C[C@@H]1CCCCN1c1cc(Oc2ccccc2)nc(NC(=S)NC2CC2)n1 |
| InChI | InChI=1S/C20H25N5OS/c1-14-7-5-6-12-25(14)17-13-18(26-16-8-3-2-4-9-16)23-19(22-17)24-20(27)21-15-10-11-15/h2-4,8-9,13-15H,5-7,10-12H2,1H3,(H2,21,22,23,24,27)/t14-/m1/s1 |
| InChIKey | LBOSOQJTVDLLKC-CQSZACIVSA-N |
| XLogP | 4.10 |
| TPSA | 62.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.52 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|