C21H27N5OS — CID 100790930
1-cyclohexyl-3-(4-phenoxy-6-pyrrolidin-1-ylpyrimidin-2-yl)thiourea (PubChem CID 100790930) has the molecular formula C21H27N5OS and a molecular weight of 397.55 g/mol. Its IUPAC name is 1-cyclohexyl-3-(4-phenoxy-6-pyrrolidin-1-ylpyrimidin-2-yl)thiourea.
| Compound Name | 1-cyclohexyl-3-(4-phenoxy-6-pyrrolidin-1-ylpyrimidin-2-yl)thiourea |
|---|---|
| PubChem CID | 100790930 |
| Molecular Formula | C21H27N5OS |
| Molecular Weight | 397.55 g/mol |
| Exact Mass | 397.19 |
| IUPAC Name | 1-cyclohexyl-3-(4-phenoxy-6-pyrrolidin-1-ylpyrimidin-2-yl)thiourea |
| SMILES | S=C(Nc1nc(Oc2ccccc2)cc(N2CCCC2)n1)NC1CCCCC1 |
| InChI | InChI=1S/C21H27N5OS/c28-21(22-16-9-3-1-4-10-16)25-20-23-18(26-13-7-8-14-26)15-19(24-20)27-17-11-5-2-6-12-17/h2,5-6,11-12,15-16H,1,3-4,7-10,13-14H2,(H2,22,23,24,25,28) |
| InChIKey | BEPZFYKHEAGBKO-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 62.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.55 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|