C24H27N5OS — CID 133197386
1-(4-phenoxy-6-piperidin-1-ylpyrimidin-2-yl)-3-(1-phenylethyl)thiourea (PubChem CID 133197386) has the molecular formula C24H27N5OS and a molecular weight of 433.58 g/mol. Its IUPAC name is 1-(4-phenoxy-6-piperidin-1-ylpyrimidin-2-yl)-3-(1-phenylethyl)thiourea.
| Compound Name | 1-(4-phenoxy-6-piperidin-1-ylpyrimidin-2-yl)-3-(1-phenylethyl)thiourea |
|---|---|
| PubChem CID | 133197386 |
| Molecular Formula | C24H27N5OS |
| Molecular Weight | 433.58 g/mol |
| Exact Mass | 433.19 |
| IUPAC Name | 1-(4-phenoxy-6-piperidin-1-ylpyrimidin-2-yl)-3-(1-phenylethyl)thiourea |
| SMILES | CC(NC(=S)Nc1nc(Oc2ccccc2)cc(N2CCCCC2)n1)c1ccccc1 |
| InChI | InChI=1S/C24H27N5OS/c1-18(19-11-5-2-6-12-19)25-24(31)28-23-26-21(29-15-9-4-10-16-29)17-22(27-23)30-20-13-7-3-8-14-20/h2-3,5-8,11-14,17-18H,4,9-10,15-16H2,1H3,(H2,25,26,27,28,31) |
| InChIKey | JAWXHXYXUYUJOH-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 62.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.58 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|