C25H22N4O2S — CID 133197438
1-(4,6-diphenoxypyrimidin-2-yl)-3-(1-phenylethyl)thiourea (PubChem CID 133197438) has the molecular formula C25H22N4O2S and a molecular weight of 442.54 g/mol. Its IUPAC name is 1-(4,6-diphenoxypyrimidin-2-yl)-3-(1-phenylethyl)thiourea.
| Compound Name | 1-(4,6-diphenoxypyrimidin-2-yl)-3-(1-phenylethyl)thiourea |
|---|---|
| PubChem CID | 133197438 |
| Molecular Formula | C25H22N4O2S |
| Molecular Weight | 442.54 g/mol |
| Exact Mass | 442.15 |
| IUPAC Name | 1-(4,6-diphenoxypyrimidin-2-yl)-3-(1-phenylethyl)thiourea |
| SMILES | CC(NC(=S)Nc1nc(Oc2ccccc2)cc(Oc2ccccc2)n1)c1ccccc1 |
| InChI | InChI=1S/C25H22N4O2S/c1-18(19-11-5-2-6-12-19)26-25(32)29-24-27-22(30-20-13-7-3-8-14-20)17-23(28-24)31-21-15-9-4-10-16-21/h2-18H,1H3,(H2,26,27,28,29,32) |
| InChIKey | YOAFXWMAYGCWQD-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 68.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.54 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|