C23H31N5OS — CID 100791214
1-cycloheptyl-3-(4-phenoxy-6-piperidin-1-ylpyrimidin-2-yl)thiourea (PubChem CID 100791214) has the molecular formula C23H31N5OS and a molecular weight of 425.60 g/mol. Its IUPAC name is 1-cycloheptyl-3-(4-phenoxy-6-piperidin-1-ylpyrimidin-2-yl)thiourea.
| Compound Name | 1-cycloheptyl-3-(4-phenoxy-6-piperidin-1-ylpyrimidin-2-yl)thiourea |
|---|---|
| PubChem CID | 100791214 |
| Molecular Formula | C23H31N5OS |
| Molecular Weight | 425.60 g/mol |
| Exact Mass | 425.22 |
| IUPAC Name | 1-cycloheptyl-3-(4-phenoxy-6-piperidin-1-ylpyrimidin-2-yl)thiourea |
| SMILES | S=C(Nc1nc(Oc2ccccc2)cc(N2CCCCC2)n1)NC1CCCCCC1 |
| InChI | InChI=1S/C23H31N5OS/c30-23(24-18-11-5-1-2-6-12-18)27-22-25-20(28-15-9-4-10-16-28)17-21(26-22)29-19-13-7-3-8-14-19/h3,7-8,13-14,17-18H,1-2,4-6,9-12,15-16H2,(H2,24,25,26,27,30) |
| InChIKey | PFSOFXJCGVEGDZ-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 62.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.60 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|