C18H30N6OS — CID 133254329
1-(2-methoxyethyl)-3-[4-(2-methylpiperidin-1-yl)-6-pyrrolidin-1-ylpyrimidin-2-yl]thiourea (PubChem CID 133254329) has the molecular formula C18H30N6OS and a molecular weight of 378.55 g/mol. Its IUPAC name is 1-(2-methoxyethyl)-3-[4-(2-methylpiperidin-1-yl)-6-pyrrolidin-1-ylpyrimidin-2-yl]thiourea.
| Compound Name | 1-(2-methoxyethyl)-3-[4-(2-methylpiperidin-1-yl)-6-pyrrolidin-1-ylpyrimidin-2-yl]thiourea |
|---|---|
| PubChem CID | 133254329 |
| Molecular Formula | C18H30N6OS |
| Molecular Weight | 378.55 g/mol |
| Exact Mass | 378.22 |
| IUPAC Name | 1-(2-methoxyethyl)-3-[4-(2-methylpiperidin-1-yl)-6-pyrrolidin-1-ylpyrimidin-2-yl]thiourea |
| SMILES | COCCNC(=S)Nc1nc(N2CCCC2)cc(N2CCCCC2C)n1 |
| InChI | InChI=1S/C18H30N6OS/c1-14-7-3-4-11-24(14)16-13-15(23-9-5-6-10-23)20-17(21-16)22-18(26)19-8-12-25-2/h13-14H,3-12H2,1-2H3,(H2,19,20,21,22,26) |
| InChIKey | GBPOSGUXIARJFE-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 65.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.55 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|