C15H23ClN6O2S — CID 100777866
1-(4-chloro-6-morpholin-4-ylpyrimidin-2-yl)-3-(2-morpholin-4-ylethyl)thiourea (PubChem CID 100777866) has the molecular formula C15H23ClN6O2S and a molecular weight of 386.91 g/mol. Its IUPAC name is 1-(4-chloro-6-morpholin-4-ylpyrimidin-2-yl)-3-(2-morpholin-4-ylethyl)thiourea.
| Compound Name | 1-(4-chloro-6-morpholin-4-ylpyrimidin-2-yl)-3-(2-morpholin-4-ylethyl)thiourea |
|---|---|
| PubChem CID | 100777866 |
| Molecular Formula | C15H23ClN6O2S |
| Molecular Weight | 386.91 g/mol |
| Exact Mass | 386.13 |
| IUPAC Name | 1-(4-chloro-6-morpholin-4-ylpyrimidin-2-yl)-3-(2-morpholin-4-ylethyl)thiourea |
| SMILES | S=C(NCCN1CCOCC1)Nc1nc(Cl)cc(N2CCOCC2)n1 |
| InChI | InChI=1S/C15H23ClN6O2S/c16-12-11-13(22-5-9-24-10-6-22)19-14(18-12)20-15(25)17-1-2-21-3-7-23-8-4-21/h11H,1-10H2,(H2,17,18,19,20,25) |
| InChIKey | CDMAKUIGBNBCIM-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 74.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.91 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|