C20H32N6O2S — CID 125047069
1-[4-[(3S)-3-methylpiperidin-1-yl]-6-morpholin-4-ylpyrimidin-2-yl]-3-[[(2R)-oxolan-2-yl]methyl]thiourea (PubChem CID 125047069) has the molecular formula C20H32N6O2S and a molecular weight of 420.58 g/mol. Its IUPAC name is 1-[4-[(3S)-3-methylpiperidin-1-yl]-6-morpholin-4-ylpyrimidin-2-yl]-3-[[(2R)-oxolan-2-yl]methyl]thiourea.
| Compound Name | 1-[4-[(3S)-3-methylpiperidin-1-yl]-6-morpholin-4-ylpyrimidin-2-yl]-3-[[(2R)-oxolan-2-yl]methyl]thiourea |
|---|---|
| PubChem CID | 125047069 |
| Molecular Formula | C20H32N6O2S |
| Molecular Weight | 420.58 g/mol |
| Exact Mass | 420.23 |
| IUPAC Name | 1-[4-[(3S)-3-methylpiperidin-1-yl]-6-morpholin-4-ylpyrimidin-2-yl]-3-[[(2R)-oxolan-2-yl]methyl]thiourea |
| SMILES | C[C@H]1CCCN(c2cc(N3CCOCC3)nc(NC(=S)NC[C@H]3CCCO3)n2)C1 |
| InChI | InChI=1S/C20H32N6O2S/c1-15-4-2-6-26(14-15)18-12-17(25-7-10-27-11-8-25)22-19(23-18)24-20(29)21-13-16-5-3-9-28-16/h12,15-16H,2-11,13-14H2,1H3,(H2,21,22,23,24,29)/t15-,16+/m0/s1 |
| InChIKey | WXSBUUDVHSLCDS-JKSUJKDBSA-N |
| XLogP | 2.01 |
| TPSA | 74.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.58 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|