C17H27N5OS — CID 125047108
1-[4-methyl-6-[(3S)-3-methylpiperidin-1-yl]pyrimidin-2-yl]-3-[[(2S)-oxolan-2-yl]methyl]thiourea (PubChem CID 125047108) has the molecular formula C17H27N5OS and a molecular weight of 349.50 g/mol. Its IUPAC name is 1-[4-methyl-6-[(3S)-3-methylpiperidin-1-yl]pyrimidin-2-yl]-3-[[(2S)-oxolan-2-yl]methyl]thiourea.
| Compound Name | 1-[4-methyl-6-[(3S)-3-methylpiperidin-1-yl]pyrimidin-2-yl]-3-[[(2S)-oxolan-2-yl]methyl]thiourea |
|---|---|
| PubChem CID | 125047108 |
| Molecular Formula | C17H27N5OS |
| Molecular Weight | 349.50 g/mol |
| Exact Mass | 349.19 |
| IUPAC Name | 1-[4-methyl-6-[(3S)-3-methylpiperidin-1-yl]pyrimidin-2-yl]-3-[[(2S)-oxolan-2-yl]methyl]thiourea |
| SMILES | Cc1cc(N2CCC[C@H](C)C2)nc(NC(=S)NC[C@@H]2CCCO2)n1 |
| InChI | InChI=1S/C17H27N5OS/c1-12-5-3-7-22(11-12)15-9-13(2)19-16(20-15)21-17(24)18-10-14-6-4-8-23-14/h9,12,14H,3-8,10-11H2,1-2H3,(H2,18,19,20,21,24)/t12-,14-/m0/s1 |
| InChIKey | XTRFYDKKJQXXEO-JSGCOSHPSA-N |
| XLogP | 2.49 |
| TPSA | 62.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.50 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|