C18H29N5OS — CID 100778312
1-[4-[(3R,5S)-3,5-dimethylpiperidin-1-yl]-6-methylpyrimidin-2-yl]-3-[[(2S)-oxolan-2-yl]methyl]thiourea (PubChem CID 100778312) has the molecular formula C18H29N5OS and a molecular weight of 363.53 g/mol. Its IUPAC name is 1-[4-[(3R,5S)-3,5-dimethylpiperidin-1-yl]-6-methylpyrimidin-2-yl]-3-[[(2S)-oxolan-2-yl]methyl]thiourea.
| Compound Name | 1-[4-[(3R,5S)-3,5-dimethylpiperidin-1-yl]-6-methylpyrimidin-2-yl]-3-[[(2S)-oxolan-2-yl]methyl]thiourea |
|---|---|
| PubChem CID | 100778312 |
| Molecular Formula | C18H29N5OS |
| Molecular Weight | 363.53 g/mol |
| Exact Mass | 363.21 |
| IUPAC Name | 1-[4-[(3R,5S)-3,5-dimethylpiperidin-1-yl]-6-methylpyrimidin-2-yl]-3-[[(2S)-oxolan-2-yl]methyl]thiourea |
| SMILES | Cc1cc(N2C[C@H](C)C[C@H](C)C2)nc(NC(=S)NC[C@@H]2CCCO2)n1 |
| InChI | InChI=1S/C18H29N5OS/c1-12-7-13(2)11-23(10-12)16-8-14(3)20-17(21-16)22-18(25)19-9-15-5-4-6-24-15/h8,12-13,15H,4-7,9-11H2,1-3H3,(H2,19,20,21,22,25)/t12-,13+,15-/m0/s1 |
| InChIKey | JWCNGNPQDJPGPY-GUTXKFCHSA-N |
| XLogP | 2.73 |
| TPSA | 62.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.53 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|