C17H20N4O2S — CID 100778338
1-(4-methyl-6-phenoxypyrimidin-2-yl)-3-[[(2S)-oxolan-2-yl]methyl]thiourea (PubChem CID 100778338) has the molecular formula C17H20N4O2S and a molecular weight of 344.44 g/mol. Its IUPAC name is 1-(4-methyl-6-phenoxypyrimidin-2-yl)-3-[[(2S)-oxolan-2-yl]methyl]thiourea.
| Compound Name | 1-(4-methyl-6-phenoxypyrimidin-2-yl)-3-[[(2S)-oxolan-2-yl]methyl]thiourea |
|---|---|
| PubChem CID | 100778338 |
| Molecular Formula | C17H20N4O2S |
| Molecular Weight | 344.44 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | 1-(4-methyl-6-phenoxypyrimidin-2-yl)-3-[[(2S)-oxolan-2-yl]methyl]thiourea |
| SMILES | Cc1cc(Oc2ccccc2)nc(NC(=S)NC[C@@H]2CCCO2)n1 |
| InChI | InChI=1S/C17H20N4O2S/c1-12-10-15(23-13-6-3-2-4-7-13)20-16(19-12)21-17(24)18-11-14-8-5-9-22-14/h2-4,6-7,10,14H,5,8-9,11H2,1H3,(H2,18,19,20,21,24)/t14-/m0/s1 |
| InChIKey | IKWJSGGEJYZPCA-AWEZNQCLSA-N |
| XLogP | 3.04 |
| TPSA | 68.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.44 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|