C21H27ClN6OS — CID 17089574
1-[N'-[2-(4-chlorophenyl)ethyl]-N-(4,6-dimethylpyrimidin-2-yl)carbamimidoyl]-3-(oxolan-2-ylmethyl)thiourea (PubChem CID 17089574) has the molecular formula C21H27ClN6OS and a molecular weight of 447.01 g/mol. Its IUPAC name is 1-[N'-[2-(4-chlorophenyl)ethyl]-N-(4,6-dimethylpyrimidin-2-yl)carbamimidoyl]-3-(oxolan-2-ylmethyl)thiourea.
| Compound Name | 1-[N'-[2-(4-chlorophenyl)ethyl]-N-(4,6-dimethylpyrimidin-2-yl)carbamimidoyl]-3-(oxolan-2-ylmethyl)thiourea |
|---|---|
| PubChem CID | 17089574 |
| Molecular Formula | C21H27ClN6OS |
| Molecular Weight | 447.01 g/mol |
| Exact Mass | 446.17 |
| IUPAC Name | 1-[N'-[2-(4-chlorophenyl)ethyl]-N-(4,6-dimethylpyrimidin-2-yl)carbamimidoyl]-3-(oxolan-2-ylmethyl)thiourea |
| SMILES | Cc1cc(C)nc(N/C(=N/CCc2ccc(Cl)cc2)NC(=S)NCC2CCCO2)n1 |
| InChI | InChI=1S/C21H27ClN6OS/c1-14-12-15(2)26-20(25-14)27-19(23-10-9-16-5-7-17(22)8-6-16)28-21(30)24-13-18-4-3-11-29-18/h5-8,12,18H,3-4,9-11,13H2,1-2H3,(H3,23,24,25,26,27,28,30) |
| InChIKey | MDKGFEARXJBKSS-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 83.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.01 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|