C23H25ClN6OS — CID 17090130
1-(2-chloro-4-methylphenyl)-3-[N-(4,6-dimethylpyrimidin-2-yl)-N'-[2-(4-hydroxyphenyl)ethyl]carbamimidoyl]thiourea (PubChem CID 17090130) has the molecular formula C23H25ClN6OS and a molecular weight of 469.01 g/mol. Its IUPAC name is 1-(2-chloro-4-methylphenyl)-3-[N-(4,6-dimethylpyrimidin-2-yl)-N'-[2-(4-hydroxyphenyl)ethyl]carbamimidoyl]thiourea.
| Compound Name | 1-(2-chloro-4-methylphenyl)-3-[N-(4,6-dimethylpyrimidin-2-yl)-N'-[2-(4-hydroxyphenyl)ethyl]carbamimidoyl]thiourea |
|---|---|
| PubChem CID | 17090130 |
| Molecular Formula | C23H25ClN6OS |
| Molecular Weight | 469.01 g/mol |
| Exact Mass | 468.15 |
| IUPAC Name | 1-(2-chloro-4-methylphenyl)-3-[N-(4,6-dimethylpyrimidin-2-yl)-N'-[2-(4-hydroxyphenyl)ethyl]carbamimidoyl]thiourea |
| SMILES | Cc1ccc(NC(=S)N/C(=N\CCc2ccc(O)cc2)Nc2nc(C)cc(C)n2)c(Cl)c1 |
| InChI | InChI=1S/C23H25ClN6OS/c1-14-4-9-20(19(24)12-14)28-23(32)30-21(29-22-26-15(2)13-16(3)27-22)25-11-10-17-5-7-18(31)8-6-17/h4-9,12-13,31H,10-11H2,1-3H3,(H3,25,26,27,28,29,30,32) |
| InChIKey | ZJPGULJHXIUSMZ-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 94.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.01 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|