C24H27ClN6O2S — CID 17089470
1-(4-chloro-2,5-dimethoxyphenyl)-3-[N-(4,6-dimethylpyrimidin-2-yl)-N'-(2-phenylethyl)carbamimidoyl]thiourea (PubChem CID 17089470) has the molecular formula C24H27ClN6O2S and a molecular weight of 499.04 g/mol. Its IUPAC name is 1-(4-chloro-2,5-dimethoxyphenyl)-3-[N-(4,6-dimethylpyrimidin-2-yl)-N'-(2-phenylethyl)carbamimidoyl]thiourea.
| Compound Name | 1-(4-chloro-2,5-dimethoxyphenyl)-3-[N-(4,6-dimethylpyrimidin-2-yl)-N'-(2-phenylethyl)carbamimidoyl]thiourea |
|---|---|
| PubChem CID | 17089470 |
| Molecular Formula | C24H27ClN6O2S |
| Molecular Weight | 499.04 g/mol |
| Exact Mass | 498.16 |
| IUPAC Name | 1-(4-chloro-2,5-dimethoxyphenyl)-3-[N-(4,6-dimethylpyrimidin-2-yl)-N'-(2-phenylethyl)carbamimidoyl]thiourea |
| SMILES | COc1cc(NC(=S)N/C(=N/CCc2ccccc2)Nc2nc(C)cc(C)n2)c(OC)cc1Cl |
| InChI | InChI=1S/C24H27ClN6O2S/c1-15-12-16(2)28-23(27-15)30-22(26-11-10-17-8-6-5-7-9-17)31-24(34)29-19-14-20(32-3)18(25)13-21(19)33-4/h5-9,12-14H,10-11H2,1-4H3,(H3,26,27,28,29,30,31,34) |
| InChIKey | KZZKJGBRCKABDF-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 92.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.04 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|