C20H27ClN6O4S — CID 17088903
1-(4-chloro-2,5-dimethoxyphenyl)-3-[N'-(2,2-dimethoxyethyl)-N-(4,6-dimethylpyrimidin-2-yl)carbamimidoyl]thiourea (PubChem CID 17088903) has the molecular formula C20H27ClN6O4S and a molecular weight of 482.99 g/mol. Its IUPAC name is 1-(4-chloro-2,5-dimethoxyphenyl)-3-[N'-(2,2-dimethoxyethyl)-N-(4,6-dimethylpyrimidin-2-yl)carbamimidoyl]thiourea.
| Compound Name | 1-(4-chloro-2,5-dimethoxyphenyl)-3-[N'-(2,2-dimethoxyethyl)-N-(4,6-dimethylpyrimidin-2-yl)carbamimidoyl]thiourea |
|---|---|
| PubChem CID | 17088903 |
| Molecular Formula | C20H27ClN6O4S |
| Molecular Weight | 482.99 g/mol |
| Exact Mass | 482.15 |
| IUPAC Name | 1-(4-chloro-2,5-dimethoxyphenyl)-3-[N'-(2,2-dimethoxyethyl)-N-(4,6-dimethylpyrimidin-2-yl)carbamimidoyl]thiourea |
| SMILES | COc1cc(NC(=S)N/C(=N/CC(OC)OC)Nc2nc(C)cc(C)n2)c(OC)cc1Cl |
| InChI | InChI=1S/C20H27ClN6O4S/c1-11-7-12(2)24-19(23-11)26-18(22-10-17(30-5)31-6)27-20(32)25-14-9-15(28-3)13(21)8-16(14)29-4/h7-9,17H,10H2,1-6H3,(H3,22,23,24,25,26,27,32) |
| InChIKey | UKFBYZFUAPYXMU-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 111.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.99 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|