C22H22ClFN6S — CID 17089420
1-(2-chloro-4-methylphenyl)-3-[N-(4,6-dimethylpyrimidin-2-yl)-N'-[(4-fluorophenyl)methyl]carbamimidoyl]thiourea (PubChem CID 17089420) has the molecular formula C22H22ClFN6S and a molecular weight of 456.98 g/mol. Its IUPAC name is 1-(2-chloro-4-methylphenyl)-3-[N-(4,6-dimethylpyrimidin-2-yl)-N'-[(4-fluorophenyl)methyl]carbamimidoyl]thiourea.
| Compound Name | 1-(2-chloro-4-methylphenyl)-3-[N-(4,6-dimethylpyrimidin-2-yl)-N'-[(4-fluorophenyl)methyl]carbamimidoyl]thiourea |
|---|---|
| PubChem CID | 17089420 |
| Molecular Formula | C22H22ClFN6S |
| Molecular Weight | 456.98 g/mol |
| Exact Mass | 456.13 |
| IUPAC Name | 1-(2-chloro-4-methylphenyl)-3-[N-(4,6-dimethylpyrimidin-2-yl)-N'-[(4-fluorophenyl)methyl]carbamimidoyl]thiourea |
| SMILES | Cc1ccc(NC(=S)N/C(=N\Cc2ccc(F)cc2)Nc2nc(C)cc(C)n2)c(Cl)c1 |
| InChI | InChI=1S/C22H22ClFN6S/c1-13-4-9-19(18(23)10-13)28-22(31)30-20(25-12-16-5-7-17(24)8-6-16)29-21-26-14(2)11-15(3)27-21/h4-11H,12H2,1-3H3,(H3,25,26,27,28,29,30,31) |
| InChIKey | TUQAIRJWBISCSD-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 74.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.98 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|