C24H27ClN6OS — CID 17089502
1-(2-chloro-4-methylphenyl)-3-[N-(4,6-dimethylpyrimidin-2-yl)-N'-[2-(4-methoxyphenyl)ethyl]carbamimidoyl]thiourea (PubChem CID 17089502) has the molecular formula C24H27ClN6OS and a molecular weight of 483.04 g/mol. Its IUPAC name is 1-(2-chloro-4-methylphenyl)-3-[N-(4,6-dimethylpyrimidin-2-yl)-N'-[2-(4-methoxyphenyl)ethyl]carbamimidoyl]thiourea.
| Compound Name | 1-(2-chloro-4-methylphenyl)-3-[N-(4,6-dimethylpyrimidin-2-yl)-N'-[2-(4-methoxyphenyl)ethyl]carbamimidoyl]thiourea |
|---|---|
| PubChem CID | 17089502 |
| Molecular Formula | C24H27ClN6OS |
| Molecular Weight | 483.04 g/mol |
| Exact Mass | 482.17 |
| IUPAC Name | 1-(2-chloro-4-methylphenyl)-3-[N-(4,6-dimethylpyrimidin-2-yl)-N'-[2-(4-methoxyphenyl)ethyl]carbamimidoyl]thiourea |
| SMILES | COc1ccc(CC/N=C(\NC(=S)Nc2ccc(C)cc2Cl)Nc2nc(C)cc(C)n2)cc1 |
| InChI | InChI=1S/C24H27ClN6OS/c1-15-5-10-21(20(25)13-15)29-24(33)31-22(30-23-27-16(2)14-17(3)28-23)26-12-11-18-6-8-19(32-4)9-7-18/h5-10,13-14H,11-12H2,1-4H3,(H3,26,27,28,29,30,31,33) |
| InChIKey | SZTMDAVUOMGQLN-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 83.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.04 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|