C25H29ClN6O3S — CID 17089510
1-(4-chloro-2,5-dimethoxyphenyl)-3-[N-(4,6-dimethylpyrimidin-2-yl)-N'-[2-(4-methoxyphenyl)ethyl]carbamimidoyl]thiourea (PubChem CID 17089510) has the molecular formula C25H29ClN6O3S and a molecular weight of 529.07 g/mol. Its IUPAC name is 1-(4-chloro-2,5-dimethoxyphenyl)-3-[N-(4,6-dimethylpyrimidin-2-yl)-N'-[2-(4-methoxyphenyl)ethyl]carbamimidoyl]thiourea.
| Compound Name | 1-(4-chloro-2,5-dimethoxyphenyl)-3-[N-(4,6-dimethylpyrimidin-2-yl)-N'-[2-(4-methoxyphenyl)ethyl]carbamimidoyl]thiourea |
|---|---|
| PubChem CID | 17089510 |
| Molecular Formula | C25H29ClN6O3S |
| Molecular Weight | 529.07 g/mol |
| Exact Mass | 528.17 |
| IUPAC Name | 1-(4-chloro-2,5-dimethoxyphenyl)-3-[N-(4,6-dimethylpyrimidin-2-yl)-N'-[2-(4-methoxyphenyl)ethyl]carbamimidoyl]thiourea |
| SMILES | COc1ccc(CC/N=C(/NC(=S)Nc2cc(OC)c(Cl)cc2OC)Nc2nc(C)cc(C)n2)cc1 |
| InChI | InChI=1S/C25H29ClN6O3S/c1-15-12-16(2)29-24(28-15)31-23(27-11-10-17-6-8-18(33-3)9-7-17)32-25(36)30-20-14-21(34-4)19(26)13-22(20)35-5/h6-9,12-14H,10-11H2,1-5H3,(H3,27,28,29,30,31,32,36) |
| InChIKey | LKQOGMDOECCUJK-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 101.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.07 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|