C22H22Cl2N6OS — CID 17089348
1-(5-chloro-2-methoxyphenyl)-3-[N'-[(4-chlorophenyl)methyl]-N-(4,6-dimethylpyrimidin-2-yl)carbamimidoyl]thiourea (PubChem CID 17089348) has the molecular formula C22H22Cl2N6OS and a molecular weight of 489.43 g/mol. Its IUPAC name is 1-(5-chloro-2-methoxyphenyl)-3-[N'-[(4-chlorophenyl)methyl]-N-(4,6-dimethylpyrimidin-2-yl)carbamimidoyl]thiourea.
| Compound Name | 1-(5-chloro-2-methoxyphenyl)-3-[N'-[(4-chlorophenyl)methyl]-N-(4,6-dimethylpyrimidin-2-yl)carbamimidoyl]thiourea |
|---|---|
| PubChem CID | 17089348 |
| Molecular Formula | C22H22Cl2N6OS |
| Molecular Weight | 489.43 g/mol |
| Exact Mass | 488.10 |
| IUPAC Name | 1-(5-chloro-2-methoxyphenyl)-3-[N'-[(4-chlorophenyl)methyl]-N-(4,6-dimethylpyrimidin-2-yl)carbamimidoyl]thiourea |
| SMILES | COc1ccc(Cl)cc1NC(=S)N/C(=N\Cc1ccc(Cl)cc1)Nc1nc(C)cc(C)n1 |
| InChI | InChI=1S/C22H22Cl2N6OS/c1-13-10-14(2)27-21(26-13)29-20(25-12-15-4-6-16(23)7-5-15)30-22(32)28-18-11-17(24)8-9-19(18)31-3/h4-11H,12H2,1-3H3,(H3,25,26,27,28,29,30,32) |
| InChIKey | DVXKDBULVRDHAJ-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 83.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.43 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|