C23H23ClN6OS — CID 17089350
1-(4-acetylphenyl)-3-[N'-[(4-chlorophenyl)methyl]-N-(4,6-dimethylpyrimidin-2-yl)carbamimidoyl]thiourea (PubChem CID 17089350) has the molecular formula C23H23ClN6OS and a molecular weight of 467.00 g/mol. Its IUPAC name is 1-(4-acetylphenyl)-3-[N'-[(4-chlorophenyl)methyl]-N-(4,6-dimethylpyrimidin-2-yl)carbamimidoyl]thiourea.
| Compound Name | 1-(4-acetylphenyl)-3-[N'-[(4-chlorophenyl)methyl]-N-(4,6-dimethylpyrimidin-2-yl)carbamimidoyl]thiourea |
|---|---|
| PubChem CID | 17089350 |
| Molecular Formula | C23H23ClN6OS |
| Molecular Weight | 467.00 g/mol |
| Exact Mass | 466.13 |
| IUPAC Name | 1-(4-acetylphenyl)-3-[N'-[(4-chlorophenyl)methyl]-N-(4,6-dimethylpyrimidin-2-yl)carbamimidoyl]thiourea |
| SMILES | CC(=O)c1ccc(NC(=S)N/C(=N\Cc2ccc(Cl)cc2)Nc2nc(C)cc(C)n2)cc1 |
| InChI | InChI=1S/C23H23ClN6OS/c1-14-12-15(2)27-22(26-14)29-21(25-13-17-4-8-19(24)9-5-17)30-23(32)28-20-10-6-18(7-11-20)16(3)31/h4-12H,13H2,1-3H3,(H3,25,26,27,28,29,30,32) |
| InChIKey | GUOITXLTTUKJGF-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 91.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.00 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|