C25H26N6O4S — CID 17089268
dimethyl 5-[[N'-benzyl-N-(4,6-dimethylpyrimidin-2-yl)carbamimidoyl]carbamothioylamino]benzene-1,3-dicarboxylate (PubChem CID 17089268) has the molecular formula C25H26N6O4S and a molecular weight of 506.59 g/mol. Its IUPAC name is dimethyl 5-[[N'-benzyl-N-(4,6-dimethylpyrimidin-2-yl)carbamimidoyl]carbamothioylamino]benzene-1,3-dicarboxylate.
| Compound Name | dimethyl 5-[[N'-benzyl-N-(4,6-dimethylpyrimidin-2-yl)carbamimidoyl]carbamothioylamino]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 17089268 |
| Molecular Formula | C25H26N6O4S |
| Molecular Weight | 506.59 g/mol |
| Exact Mass | 506.17 |
| IUPAC Name | dimethyl 5-[[N'-benzyl-N-(4,6-dimethylpyrimidin-2-yl)carbamimidoyl]carbamothioylamino]benzene-1,3-dicarboxylate |
| SMILES | COC(=O)c1cc(NC(=S)N/C(=N/Cc2ccccc2)Nc2nc(C)cc(C)n2)cc(C(=O)OC)c1 |
| InChI | InChI=1S/C25H26N6O4S/c1-15-10-16(2)28-24(27-15)30-23(26-14-17-8-6-5-7-9-17)31-25(36)29-20-12-18(21(32)34-3)11-19(13-20)22(33)35-4/h5-13H,14H2,1-4H3,(H3,26,27,28,29,30,31,36) |
| InChIKey | LACKPBZQTPGZTM-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 126.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.59 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|