C23H24N6O5S — CID 17089641
dimethyl 5-[[N-(4,6-dimethylpyrimidin-2-yl)-N'-(furan-2-ylmethyl)carbamimidoyl]carbamothioylamino]benzene-1,3-dicarboxylate (PubChem CID 17089641) has the molecular formula C23H24N6O5S and a molecular weight of 496.55 g/mol. Its IUPAC name is dimethyl 5-[[N-(4,6-dimethylpyrimidin-2-yl)-N'-(furan-2-ylmethyl)carbamimidoyl]carbamothioylamino]benzene-1,3-dicarboxylate.
| Compound Name | dimethyl 5-[[N-(4,6-dimethylpyrimidin-2-yl)-N'-(furan-2-ylmethyl)carbamimidoyl]carbamothioylamino]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 17089641 |
| Molecular Formula | C23H24N6O5S |
| Molecular Weight | 496.55 g/mol |
| Exact Mass | 496.15 |
| IUPAC Name | dimethyl 5-[[N-(4,6-dimethylpyrimidin-2-yl)-N'-(furan-2-ylmethyl)carbamimidoyl]carbamothioylamino]benzene-1,3-dicarboxylate |
| SMILES | COC(=O)c1cc(NC(=S)N/C(=N/Cc2ccco2)Nc2nc(C)cc(C)n2)cc(C(=O)OC)c1 |
| InChI | InChI=1S/C23H24N6O5S/c1-13-8-14(2)26-22(25-13)28-21(24-12-18-6-5-7-34-18)29-23(35)27-17-10-15(19(30)32-3)9-16(11-17)20(31)33-4/h5-11H,12H2,1-4H3,(H3,24,25,26,27,28,29,35) |
| InChIKey | RFEAZFQICPLDCQ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 139.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.55 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|