C23H23F3N6OS — CID 17089041
1-[N-(4,6-dimethylpyrimidin-2-yl)-N'-[(2-methoxyphenyl)methyl]carbamimidoyl]-3-[4-(trifluoromethyl)phenyl]thiourea (PubChem CID 17089041) has the molecular formula C23H23F3N6OS and a molecular weight of 488.54 g/mol. Its IUPAC name is 1-[N-(4,6-dimethylpyrimidin-2-yl)-N'-[(2-methoxyphenyl)methyl]carbamimidoyl]-3-[4-(trifluoromethyl)phenyl]thiourea.
| Compound Name | 1-[N-(4,6-dimethylpyrimidin-2-yl)-N'-[(2-methoxyphenyl)methyl]carbamimidoyl]-3-[4-(trifluoromethyl)phenyl]thiourea |
|---|---|
| PubChem CID | 17089041 |
| Molecular Formula | C23H23F3N6OS |
| Molecular Weight | 488.54 g/mol |
| Exact Mass | 488.16 |
| IUPAC Name | 1-[N-(4,6-dimethylpyrimidin-2-yl)-N'-[(2-methoxyphenyl)methyl]carbamimidoyl]-3-[4-(trifluoromethyl)phenyl]thiourea |
| SMILES | COc1ccccc1C/N=C(\NC(=S)Nc1ccc(C(F)(F)F)cc1)Nc1nc(C)cc(C)n1 |
| InChI | InChI=1S/C23H23F3N6OS/c1-14-12-15(2)29-21(28-14)31-20(27-13-16-6-4-5-7-19(16)33-3)32-22(34)30-18-10-8-17(9-11-18)23(24,25)26/h4-12H,13H2,1-3H3,(H3,27,28,29,30,31,32,34) |
| InChIKey | MVIYDVBMFPBAGM-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 83.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.54 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|