C22H23ClN6O2 — CID 17089048
1-(3-chlorophenyl)-3-[N-(4,6-dimethylpyrimidin-2-yl)-N'-[(2-methoxyphenyl)methyl]carbamimidoyl]urea (PubChem CID 17089048) has the molecular formula C22H23ClN6O2 and a molecular weight of 438.92 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-3-[N-(4,6-dimethylpyrimidin-2-yl)-N'-[(2-methoxyphenyl)methyl]carbamimidoyl]urea.
| Compound Name | 1-(3-chlorophenyl)-3-[N-(4,6-dimethylpyrimidin-2-yl)-N'-[(2-methoxyphenyl)methyl]carbamimidoyl]urea |
|---|---|
| PubChem CID | 17089048 |
| Molecular Formula | C22H23ClN6O2 |
| Molecular Weight | 438.92 g/mol |
| Exact Mass | 438.16 |
| IUPAC Name | 1-(3-chlorophenyl)-3-[N-(4,6-dimethylpyrimidin-2-yl)-N'-[(2-methoxyphenyl)methyl]carbamimidoyl]urea |
| SMILES | COc1ccccc1C/N=C(\NC(=O)Nc1cccc(Cl)c1)Nc1nc(C)cc(C)n1 |
| InChI | InChI=1S/C22H23ClN6O2/c1-14-11-15(2)26-21(25-14)28-20(24-13-16-7-4-5-10-19(16)31-3)29-22(30)27-18-9-6-8-17(23)12-18/h4-12H,13H2,1-3H3,(H3,24,25,26,27,28,29,30) |
| InChIKey | FESDPJLIKJEFLZ-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 100.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.92 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|