C19H20N6OS — CID 17091262
1-[N-(4,6-dimethylpyrimidin-2-yl)-N'-(thiophen-2-ylmethyl)carbamimidoyl]-3-phenylurea (PubChem CID 17091262) has the molecular formula C19H20N6OS and a molecular weight of 380.48 g/mol. Its IUPAC name is 1-[N-(4,6-dimethylpyrimidin-2-yl)-N'-(thiophen-2-ylmethyl)carbamimidoyl]-3-phenylurea.
| Compound Name | 1-[N-(4,6-dimethylpyrimidin-2-yl)-N'-(thiophen-2-ylmethyl)carbamimidoyl]-3-phenylurea |
|---|---|
| PubChem CID | 17091262 |
| Molecular Formula | C19H20N6OS |
| Molecular Weight | 380.48 g/mol |
| Exact Mass | 380.14 |
| IUPAC Name | 1-[N-(4,6-dimethylpyrimidin-2-yl)-N'-(thiophen-2-ylmethyl)carbamimidoyl]-3-phenylurea |
| SMILES | Cc1cc(C)nc(N/C(=N/Cc2cccs2)NC(=O)Nc2ccccc2)n1 |
| InChI | InChI=1S/C19H20N6OS/c1-13-11-14(2)22-18(21-13)24-17(20-12-16-9-6-10-27-16)25-19(26)23-15-7-4-3-5-8-15/h3-11H,12H2,1-2H3,(H3,20,21,22,23,24,25,26) |
| InChIKey | NJUYQPWBANKLPR-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 91.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.48 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|