C20H26ClN7O2 — CID 17089922
1-(4-chlorophenyl)-3-[N-(4,6-dimethylpyrimidin-2-yl)-N'-(2-morpholin-4-ylethyl)carbamimidoyl]urea (PubChem CID 17089922) has the molecular formula C20H26ClN7O2 and a molecular weight of 431.93 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-[N-(4,6-dimethylpyrimidin-2-yl)-N'-(2-morpholin-4-ylethyl)carbamimidoyl]urea.
| Compound Name | 1-(4-chlorophenyl)-3-[N-(4,6-dimethylpyrimidin-2-yl)-N'-(2-morpholin-4-ylethyl)carbamimidoyl]urea |
|---|---|
| PubChem CID | 17089922 |
| Molecular Formula | C20H26ClN7O2 |
| Molecular Weight | 431.93 g/mol |
| Exact Mass | 431.18 |
| IUPAC Name | 1-(4-chlorophenyl)-3-[N-(4,6-dimethylpyrimidin-2-yl)-N'-(2-morpholin-4-ylethyl)carbamimidoyl]urea |
| SMILES | Cc1cc(C)nc(N/C(=N/CCN2CCOCC2)NC(=O)Nc2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C20H26ClN7O2/c1-14-13-15(2)24-19(23-14)26-18(22-7-8-28-9-11-30-12-10-28)27-20(29)25-17-5-3-16(21)4-6-17/h3-6,13H,7-12H2,1-2H3,(H3,22,23,24,25,26,27,29) |
| InChIKey | MBCQWJCAUARUPA-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 103.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.93 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|