C22H31N7O2S — CID 17089920
1-[N-(4,6-dimethylpyrimidin-2-yl)-N'-(2-morpholin-4-ylethyl)carbamimidoyl]-3-(4-ethoxyphenyl)thiourea (PubChem CID 17089920) has the molecular formula C22H31N7O2S and a molecular weight of 457.60 g/mol. Its IUPAC name is 1-[N-(4,6-dimethylpyrimidin-2-yl)-N'-(2-morpholin-4-ylethyl)carbamimidoyl]-3-(4-ethoxyphenyl)thiourea.
| Compound Name | 1-[N-(4,6-dimethylpyrimidin-2-yl)-N'-(2-morpholin-4-ylethyl)carbamimidoyl]-3-(4-ethoxyphenyl)thiourea |
|---|---|
| PubChem CID | 17089920 |
| Molecular Formula | C22H31N7O2S |
| Molecular Weight | 457.60 g/mol |
| Exact Mass | 457.23 |
| IUPAC Name | 1-[N-(4,6-dimethylpyrimidin-2-yl)-N'-(2-morpholin-4-ylethyl)carbamimidoyl]-3-(4-ethoxyphenyl)thiourea |
| SMILES | CCOc1ccc(NC(=S)N/C(=N\CCN2CCOCC2)Nc2nc(C)cc(C)n2)cc1 |
| InChI | InChI=1S/C22H31N7O2S/c1-4-31-19-7-5-18(6-8-19)26-22(32)28-20(23-9-10-29-11-13-30-14-12-29)27-21-24-16(2)15-17(3)25-21/h5-8,15H,4,9-14H2,1-3H3,(H3,23,24,25,26,27,28,32) |
| InChIKey | RJHUPCUMWHHYDR-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 95.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.60 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|