C21H28ClN7O2 — CID 17089964
1-(4-chlorophenyl)-3-[N-(4,6-dimethylpyrimidin-2-yl)-N'-(3-morpholin-4-ylpropyl)carbamimidoyl]urea (PubChem CID 17089964) has the molecular formula C21H28ClN7O2 and a molecular weight of 445.96 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-[N-(4,6-dimethylpyrimidin-2-yl)-N'-(3-morpholin-4-ylpropyl)carbamimidoyl]urea.
| Compound Name | 1-(4-chlorophenyl)-3-[N-(4,6-dimethylpyrimidin-2-yl)-N'-(3-morpholin-4-ylpropyl)carbamimidoyl]urea |
|---|---|
| PubChem CID | 17089964 |
| Molecular Formula | C21H28ClN7O2 |
| Molecular Weight | 445.96 g/mol |
| Exact Mass | 445.20 |
| IUPAC Name | 1-(4-chlorophenyl)-3-[N-(4,6-dimethylpyrimidin-2-yl)-N'-(3-morpholin-4-ylpropyl)carbamimidoyl]urea |
| SMILES | Cc1cc(C)nc(N/C(=N/CCCN2CCOCC2)NC(=O)Nc2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C21H28ClN7O2/c1-15-14-16(2)25-20(24-15)27-19(23-8-3-9-29-10-12-31-13-11-29)28-21(30)26-18-6-4-17(22)5-7-18/h4-7,14H,3,8-13H2,1-2H3,(H3,23,24,25,26,27,28,30) |
| InChIKey | UDKNEGDXCUQYTO-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 103.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.96 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|