C23H32ClN7OS — CID 17089575
1-[N'-[2-(4-chlorophenyl)ethyl]-N-(4,6-dimethylpyrimidin-2-yl)carbamimidoyl]-3-(3-morpholin-4-ylpropyl)thiourea (PubChem CID 17089575) has the molecular formula C23H32ClN7OS and a molecular weight of 490.08 g/mol. Its IUPAC name is 1-[N'-[2-(4-chlorophenyl)ethyl]-N-(4,6-dimethylpyrimidin-2-yl)carbamimidoyl]-3-(3-morpholin-4-ylpropyl)thiourea.
| Compound Name | 1-[N'-[2-(4-chlorophenyl)ethyl]-N-(4,6-dimethylpyrimidin-2-yl)carbamimidoyl]-3-(3-morpholin-4-ylpropyl)thiourea |
|---|---|
| PubChem CID | 17089575 |
| Molecular Formula | C23H32ClN7OS |
| Molecular Weight | 490.08 g/mol |
| Exact Mass | 489.21 |
| IUPAC Name | 1-[N'-[2-(4-chlorophenyl)ethyl]-N-(4,6-dimethylpyrimidin-2-yl)carbamimidoyl]-3-(3-morpholin-4-ylpropyl)thiourea |
| SMILES | Cc1cc(C)nc(N/C(=N/CCc2ccc(Cl)cc2)NC(=S)NCCCN2CCOCC2)n1 |
| InChI | InChI=1S/C23H32ClN7OS/c1-17-16-18(2)28-22(27-17)29-21(25-10-8-19-4-6-20(24)7-5-19)30-23(33)26-9-3-11-31-12-14-32-15-13-31/h4-7,16H,3,8-15H2,1-2H3,(H3,25,26,27,28,29,30,33) |
| InChIKey | PCMHKSOZTDVOHY-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 86.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.08 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|