C23H33N7O2S — CID 17089962
1-[N-(4,6-dimethylpyrimidin-2-yl)-N'-(3-morpholin-4-ylpropyl)carbamimidoyl]-3-(4-ethoxyphenyl)thiourea (PubChem CID 17089962) has the molecular formula C23H33N7O2S and a molecular weight of 471.63 g/mol. Its IUPAC name is 1-[N-(4,6-dimethylpyrimidin-2-yl)-N'-(3-morpholin-4-ylpropyl)carbamimidoyl]-3-(4-ethoxyphenyl)thiourea.
| Compound Name | 1-[N-(4,6-dimethylpyrimidin-2-yl)-N'-(3-morpholin-4-ylpropyl)carbamimidoyl]-3-(4-ethoxyphenyl)thiourea |
|---|---|
| PubChem CID | 17089962 |
| Molecular Formula | C23H33N7O2S |
| Molecular Weight | 471.63 g/mol |
| Exact Mass | 471.24 |
| IUPAC Name | 1-[N-(4,6-dimethylpyrimidin-2-yl)-N'-(3-morpholin-4-ylpropyl)carbamimidoyl]-3-(4-ethoxyphenyl)thiourea |
| SMILES | CCOc1ccc(NC(=S)N/C(=N\CCCN2CCOCC2)Nc2nc(C)cc(C)n2)cc1 |
| InChI | InChI=1S/C23H33N7O2S/c1-4-32-20-8-6-19(7-9-20)27-23(33)29-21(28-22-25-17(2)16-18(3)26-22)24-10-5-11-30-12-14-31-15-13-30/h6-9,16H,4-5,10-15H2,1-3H3,(H3,24,25,26,27,28,29,33) |
| InChIKey | UIMTYXGJZLJAPC-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 95.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.63 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|