C21H24N6OS2 — CID 17089609
1-[N-(4,6-dimethylpyrimidin-2-yl)-N'-(thiophen-2-ylmethyl)carbamimidoyl]-3-(4-ethoxyphenyl)thiourea (PubChem CID 17089609) has the molecular formula C21H24N6OS2 and a molecular weight of 440.60 g/mol. Its IUPAC name is 1-[N-(4,6-dimethylpyrimidin-2-yl)-N'-(thiophen-2-ylmethyl)carbamimidoyl]-3-(4-ethoxyphenyl)thiourea.
| Compound Name | 1-[N-(4,6-dimethylpyrimidin-2-yl)-N'-(thiophen-2-ylmethyl)carbamimidoyl]-3-(4-ethoxyphenyl)thiourea |
|---|---|
| PubChem CID | 17089609 |
| Molecular Formula | C21H24N6OS2 |
| Molecular Weight | 440.60 g/mol |
| Exact Mass | 440.15 |
| IUPAC Name | 1-[N-(4,6-dimethylpyrimidin-2-yl)-N'-(thiophen-2-ylmethyl)carbamimidoyl]-3-(4-ethoxyphenyl)thiourea |
| SMILES | CCOc1ccc(NC(=S)N/C(=N\Cc2cccs2)Nc2nc(C)cc(C)n2)cc1 |
| InChI | InChI=1S/C21H24N6OS2/c1-4-28-17-9-7-16(8-10-17)25-21(29)27-19(22-13-18-6-5-11-30-18)26-20-23-14(2)12-15(3)24-20/h5-12H,4,13H2,1-3H3,(H3,22,23,24,25,26,27,29) |
| InChIKey | PTYAGBMHEFRGPD-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 83.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.60 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|