C25H37N7OS — CID 17089847
1-[N-(4,6-dimethylpyrimidin-2-yl)-N'-(2,2,6,6-tetramethylpiperidin-4-yl)carbamimidoyl]-3-(4-ethoxyphenyl)thiourea (PubChem CID 17089847) has the molecular formula C25H37N7OS and a molecular weight of 483.69 g/mol. Its IUPAC name is 1-[N-(4,6-dimethylpyrimidin-2-yl)-N'-(2,2,6,6-tetramethylpiperidin-4-yl)carbamimidoyl]-3-(4-ethoxyphenyl)thiourea.
| Compound Name | 1-[N-(4,6-dimethylpyrimidin-2-yl)-N'-(2,2,6,6-tetramethylpiperidin-4-yl)carbamimidoyl]-3-(4-ethoxyphenyl)thiourea |
|---|---|
| PubChem CID | 17089847 |
| Molecular Formula | C25H37N7OS |
| Molecular Weight | 483.69 g/mol |
| Exact Mass | 483.28 |
| IUPAC Name | 1-[N-(4,6-dimethylpyrimidin-2-yl)-N'-(2,2,6,6-tetramethylpiperidin-4-yl)carbamimidoyl]-3-(4-ethoxyphenyl)thiourea |
| SMILES | CCOc1ccc(NC(=S)N/C(=N\C2CC(C)(C)NC(C)(C)C2)Nc2nc(C)cc(C)n2)cc1 |
| InChI | InChI=1S/C25H37N7OS/c1-8-33-20-11-9-18(10-12-20)29-23(34)31-22(30-21-26-16(2)13-17(3)27-21)28-19-14-24(4,5)32-25(6,7)15-19/h9-13,19,32H,8,14-15H2,1-7H3,(H3,26,27,28,29,30,31,34) |
| InChIKey | YQLDQKHMALBGGN-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 95.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.69 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|