C17H21N5OS — CID 100564966
1-cyclopropyl-3-[4-(4-ethoxyanilino)-6-methylpyrimidin-2-yl]thiourea (PubChem CID 100564966) has the molecular formula C17H21N5OS and a molecular weight of 343.46 g/mol. Its IUPAC name is 1-cyclopropyl-3-[4-(4-ethoxyanilino)-6-methylpyrimidin-2-yl]thiourea.
| Compound Name | 1-cyclopropyl-3-[4-(4-ethoxyanilino)-6-methylpyrimidin-2-yl]thiourea |
|---|---|
| PubChem CID | 100564966 |
| Molecular Formula | C17H21N5OS |
| Molecular Weight | 343.46 g/mol |
| Exact Mass | 343.15 |
| IUPAC Name | 1-cyclopropyl-3-[4-(4-ethoxyanilino)-6-methylpyrimidin-2-yl]thiourea |
| SMILES | CCOc1ccc(Nc2cc(C)nc(NC(=S)NC3CC3)n2)cc1 |
| InChI | InChI=1S/C17H21N5OS/c1-3-23-14-8-6-12(7-9-14)19-15-10-11(2)18-16(21-15)22-17(24)20-13-4-5-13/h6-10,13H,3-5H2,1-2H3,(H3,18,19,20,21,22,24) |
| InChIKey | WQHRHZOFYFYOKD-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 71.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.46 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|