C19H27N5OS — CID 100565336
1-[4-(4-ethoxyanilino)-6-methylpyrimidin-2-yl]-3-[(2R)-pentan-2-yl]thiourea (PubChem CID 100565336) has the molecular formula C19H27N5OS and a molecular weight of 373.53 g/mol. Its IUPAC name is 1-[4-(4-ethoxyanilino)-6-methylpyrimidin-2-yl]-3-[(2R)-pentan-2-yl]thiourea.
| Compound Name | 1-[4-(4-ethoxyanilino)-6-methylpyrimidin-2-yl]-3-[(2R)-pentan-2-yl]thiourea |
|---|---|
| PubChem CID | 100565336 |
| Molecular Formula | C19H27N5OS |
| Molecular Weight | 373.53 g/mol |
| Exact Mass | 373.19 |
| IUPAC Name | 1-[4-(4-ethoxyanilino)-6-methylpyrimidin-2-yl]-3-[(2R)-pentan-2-yl]thiourea |
| SMILES | CCC[C@@H](C)NC(=S)Nc1nc(C)cc(Nc2ccc(OCC)cc2)n1 |
| InChI | InChI=1S/C19H27N5OS/c1-5-7-13(3)21-19(26)24-18-20-14(4)12-17(23-18)22-15-8-10-16(11-9-15)25-6-2/h8-13H,5-7H2,1-4H3,(H3,20,21,22,23,24,26)/t13-/m1/s1 |
| InChIKey | UCVCDMVRTRYGHD-CYBMUJFWSA-N |
| XLogP | 4.40 |
| TPSA | 71.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.53 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|