C15H19N5OS — CID 100564852
1-[4-(4-ethoxyanilino)-6-methylpyrimidin-2-yl]-3-methylthiourea (PubChem CID 100564852) has the molecular formula C15H19N5OS and a molecular weight of 317.42 g/mol. Its IUPAC name is 1-[4-(4-ethoxyanilino)-6-methylpyrimidin-2-yl]-3-methylthiourea.
| Compound Name | 1-[4-(4-ethoxyanilino)-6-methylpyrimidin-2-yl]-3-methylthiourea |
|---|---|
| PubChem CID | 100564852 |
| Molecular Formula | C15H19N5OS |
| Molecular Weight | 317.42 g/mol |
| Exact Mass | 317.13 |
| IUPAC Name | 1-[4-(4-ethoxyanilino)-6-methylpyrimidin-2-yl]-3-methylthiourea |
| SMILES | CCOc1ccc(Nc2cc(C)nc(NC(=S)NC)n2)cc1 |
| InChI | InChI=1S/C15H19N5OS/c1-4-21-12-7-5-11(6-8-12)18-13-9-10(2)17-14(19-13)20-15(22)16-3/h5-9H,4H2,1-3H3,(H3,16,17,18,19,20,22) |
| InChIKey | GRPGRTNRTZTWAI-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 71.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.42 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|